C20H36N2O4S2 — CID 10071494
3-[2-amino-3-[[2-amino-3-(3-carboxycyclohexyl)propyl]disulfanyl]propyl]cyclohexane-1-carboxylic acid (PubChem CID 10071494) has the molecular formula C20H36N2O4S2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 3-[2-amino-3-[[2-amino-3-(3-carboxycyclohexyl)propyl]disulfanyl]propyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[2-amino-3-[[2-amino-3-(3-carboxycyclohexyl)propyl]disulfanyl]propyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 10071494 |
| Molecular Formula | C20H36N2O4S2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-[2-amino-3-[[2-amino-3-(3-carboxycyclohexyl)propyl]disulfanyl]propyl]cyclohexane-1-carboxylic acid |
| SMILES | NC(CSSCC(N)CC1CCCC(C(=O)O)C1)CC1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C20H36N2O4S2/c21-17(9-13-3-1-5-15(7-13)19(23)24)11-27-28-12-18(22)10-14-4-2-6-16(8-14)20(25)26/h13-18H,1-12,21-22H2,(H,23,24)(H,25,26) |
| InChIKey | BHQIYKONBJNYLO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|