C9H17NO2 — CID 67863666
cis-(1R,3S)-3-(1-aminoethyl)cyclohexane-1-carboxylic acid (PubChem CID 67863666) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is cis-(1R,3S)-3-(1-aminoethyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(1-aminoethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67863666 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | cis-(1R,3S)-3-(1-aminoethyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(N)[C@H]1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C9H17NO2/c1-6(10)7-3-2-4-8(5-7)9(11)12/h6-8H,2-5,10H2,1H3,(H,11,12)/t6?,7-,8+/m0/s1 |
| InChIKey | YPEAXHXQYLNGJT-ZHFSPANRSA-N |
| XLogP | 1.22 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |