C20H26N4S — CID 100716021
1-(3-methyl-2-pyridinyl)-3-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea (PubChem CID 100716021) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100716021 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea |
| SMILES | Cc1cccnc1NC(=S)N[C@H](C)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26N4S/c1-15-7-6-12-21-19(15)23-20(25)22-16(2)17-8-10-18(11-9-17)24-13-4-3-5-14-24/h6-12,16H,3-5,13-14H2,1-2H3,(H2,21,22,23,25)/t16-/m1/s1 |
| InChIKey | SYEQUMKQLPYXPL-MRXNPFEDSA-N |
| XLogP | 4.43 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|