C24H24N6O3 — CID 10072145
2-[2-[(E)-[[4-(morpholine-4-carbonyl)phenyl]hydrazinylidene]methyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 10072145) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is 2-[2-[(E)-[[4-(morpholine-4-carbonyl)phenyl]hydrazinylidene]methyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-[(E)-[[4-(morpholine-4-carbonyl)phenyl]hydrazinylidene]methyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 10072145 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[2-[(E)-[[4-(morpholine-4-carbonyl)phenyl]hydrazinylidene]methyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2[nH]c(-c3ccnc(/C=N/Nc4ccc(C(=O)N5CCOCC5)cc4)c3)cc21 |
| InChI | InChI=1S/C24H24N6O3/c31-23-20-14-22(28-21(20)6-8-26-23)17-5-7-25-19(13-17)15-27-29-18-3-1-16(2-4-18)24(32)30-9-11-33-12-10-30/h1-5,7,13-15,28-29H,6,8-12H2,(H,26,31)/b27-15+ |
| InChIKey | CLUBZMIJLZBMEI-JFLMPSFJSA-N |
| XLogP | 2.28 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|