C24H24N4O5 — CID 10072342
1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]purin-6-one (PubChem CID 10072342) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]purin-6-one.
| Compound Name | 1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]purin-6-one |
|---|---|
| PubChem CID | 10072342 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]purin-6-one |
| SMILES | O=c1c2ncn([C@@H]3O[C@H](COCc4ccccc4)[C@@H](O)[C@H]3O)c2ncn1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O5/c29-20-18(13-32-12-17-9-5-2-6-10-17)33-24(21(20)30)28-15-25-19-22(28)26-14-27(23(19)31)11-16-7-3-1-4-8-16/h1-10,14-15,18,20-21,24,29-30H,11-13H2/t18-,20-,21-,24-/m1/s1 |
| InChIKey | HJXJHDPTLPBWQO-UMCMBGNQSA-N |
| XLogP | 1.48 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |