C20H29N3O3 — CID 100728103
1-N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-N',1-N'-dimethylcyclopropane-1,1-dicarboxamide (PubChem CID 100728103) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-N',1-N'-dimethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-N',1-N'-dimethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 100728103 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-N-[(2R)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-N',1-N'-dimethylcyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccccc1[C@H](CNC(=O)C1(C(=O)N(C)C)CC1)N1CCCC1 |
| InChI | InChI=1S/C20H29N3O3/c1-22(2)19(25)20(10-11-20)18(24)21-14-16(23-12-6-7-13-23)15-8-4-5-9-17(15)26-3/h4-5,8-9,16H,6-7,10-14H2,1-3H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | NGBNTVQAKOYAOP-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|