C16H20N4O5 — CID 100728562
3-[(4R)-4-butyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)propanamide (PubChem CID 100728562) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[(4R)-4-butyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)propanamide.
| Compound Name | 3-[(4R)-4-butyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 100728562 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-[(4R)-4-butyl-2,5-dioxoimidazolidin-1-yl]-N-(2-nitrophenyl)propanamide |
| SMILES | CCCC[C@H]1NC(=O)N(CCC(=O)Nc2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C16H20N4O5/c1-2-3-6-12-15(22)19(16(23)18-12)10-9-14(21)17-11-7-4-5-8-13(11)20(24)25/h4-5,7-8,12H,2-3,6,9-10H2,1H3,(H,17,21)(H,18,23)/t12-/m1/s1 |
| InChIKey | XKOFWYCWZMVROQ-GFCCVEGCSA-N |
| XLogP | 2.03 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|