C15H17N5O6S — CID 59093836
2-[(4S)-4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 59093836) has the molecular formula C15H17N5O6S and a molecular weight of 395.40 g/mol. Its IUPAC name is 2-[(4S)-4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4S)-4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59093836 |
| Molecular Formula | C15H17N5O6S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[(4S)-4-[3-[(2-nitrophenyl)carbamothioylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)N[C@@H](CCCNC(=S)Nc2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C15H17N5O6S/c21-12(22)8-19-13(23)10(18-15(19)24)5-3-7-16-14(27)17-9-4-1-2-6-11(9)20(25)26/h1-2,4,6,10H,3,5,7-8H2,(H,18,24)(H,21,22)(H2,16,17,27)/t10-/m0/s1 |
| InChIKey | WFBQMOKVORZECL-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|