C15H21N3O5 — CID 15858542
8-[(2-nitrophenyl)carbamoylamino]octanoic acid (PubChem CID 15858542) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 8-[(2-nitrophenyl)carbamoylamino]octanoic acid.
| Compound Name | 8-[(2-nitrophenyl)carbamoylamino]octanoic acid |
|---|---|
| PubChem CID | 15858542 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 8-[(2-nitrophenyl)carbamoylamino]octanoic acid |
| SMILES | O=C(O)CCCCCCCNC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O5/c19-14(20)10-4-2-1-3-7-11-16-15(21)17-12-8-5-6-9-13(12)18(22)23/h5-6,8-9H,1-4,7,10-11H2,(H,19,20)(H2,16,17,21) |
| InChIKey | SSTZBNAASBUYSC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|