C16H25NO3S — CID 100728748
(2R)-2-methyl-N-[(4-methyl-3-methylsulfonylphenyl)methyl]hexanamide (PubChem CID 100728748) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (2R)-2-methyl-N-[(4-methyl-3-methylsulfonylphenyl)methyl]hexanamide.
| Compound Name | (2R)-2-methyl-N-[(4-methyl-3-methylsulfonylphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 100728748 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R)-2-methyl-N-[(4-methyl-3-methylsulfonylphenyl)methyl]hexanamide |
| SMILES | CCCC[C@@H](C)C(=O)NCc1ccc(C)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H25NO3S/c1-5-6-7-13(3)16(18)17-11-14-9-8-12(2)15(10-14)21(4,19)20/h8-10,13H,5-7,11H2,1-4H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | JLHPQTNZFUJBGV-CYBMUJFWSA-N |
| XLogP | 2.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |