C19H29NOS — CID 176695844
2-methyl-N-[[4-(2-methyl-1-methylsulfanylprop-1-enyl)phenyl]methyl]hexanamide (PubChem CID 176695844) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is 2-methyl-N-[[4-(2-methyl-1-methylsulfanylprop-1-enyl)phenyl]methyl]hexanamide.
| Compound Name | 2-methyl-N-[[4-(2-methyl-1-methylsulfanylprop-1-enyl)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 176695844 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-methyl-N-[[4-(2-methyl-1-methylsulfanylprop-1-enyl)phenyl]methyl]hexanamide |
| SMILES | CCCCC(C)C(=O)NCc1ccc(C(SC)=C(C)C)cc1 |
| InChI | InChI=1S/C19H29NOS/c1-6-7-8-15(4)19(21)20-13-16-9-11-17(12-10-16)18(22-5)14(2)3/h9-12,15H,6-8,13H2,1-5H3,(H,20,21) |
| InChIKey | OBAKTIMUAZOESK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |