C18H14F6N6O2 — CID 10072934
4-nitro-6-(trifluoromethyl)-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1H-benzimidazole (PubChem CID 10072934) has the molecular formula C18H14F6N6O2 and a molecular weight of 460.34 g/mol. Its IUPAC name is 4-nitro-6-(trifluoromethyl)-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1H-benzimidazole.
| Compound Name | 4-nitro-6-(trifluoromethyl)-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 10072934 |
| Molecular Formula | C18H14F6N6O2 |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 4-nitro-6-(trifluoromethyl)-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc2[nH]c(N3CCN(c4ncccc4C(F)(F)F)CC3)nc12 |
| InChI | InChI=1S/C18H14F6N6O2/c19-17(20,21)10-8-12-14(13(9-10)30(31)32)27-16(26-12)29-6-4-28(5-7-29)15-11(18(22,23)24)2-1-3-25-15/h1-3,8-9H,4-7H2,(H,26,27) |
| InChIKey | VZWXFOJEQFSLIF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|