C21H17BF3N5 — CID 142886211
CID 142886211 (PubChem CID 142886211) has the molecular formula C21H17BF3N5 and a molecular weight of 407.21 g/mol.
| Compound Name | CID 142886211 |
|---|---|
| PubChem CID | 142886211 |
| Molecular Formula | C21H17BF3N5 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(F)(F)F)cc2[nH]c(N3CCN(c4nccc5ccccc45)CC3)nc12 |
| InChI | InChI=1S/C21H17BF3N5/c22-16-11-14(21(23,24)25)12-17-18(16)28-20(27-17)30-9-7-29(8-10-30)19-15-4-2-1-3-13(15)5-6-26-19/h1-6,11-12H,7-10H2,(H,27,28) |
| InChIKey | QFXKTLBJYXOVAZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|