C20H32O8S2 — CID 10073140
[(4R,5R)-4-[(4S,5R)-5-[(R)-acetyloxy(1,3-dithian-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate (PubChem CID 10073140) has the molecular formula C20H32O8S2 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(4R,5R)-4-[(4S,5R)-5-[(R)-acetyloxy(1,3-dithian-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate.
| Compound Name | [(4R,5R)-4-[(4S,5R)-5-[(R)-acetyloxy(1,3-dithian-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate |
|---|---|
| PubChem CID | 10073140 |
| Molecular Formula | C20H32O8S2 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(4R,5R)-4-[(4S,5R)-5-[(R)-acetyloxy(1,3-dithian-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1COC(C)(C)O[C@H]1[C@@H]1OC(C)(C)O[C@H]1[C@@H](OC(C)=O)C1SCCCS1 |
| InChI | InChI=1S/C20H32O8S2/c1-11(21)24-13-10-23-19(3,4)26-14(13)15-16(28-20(5,6)27-15)17(25-12(2)22)18-29-8-7-9-30-18/h13-18H,7-10H2,1-6H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | SJIDSAJBOBRJLN-NQNKBUKLSA-N |
| XLogP | 2.72 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |