C23H28BrN3O4S — CID 100731469
(2R)-2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 100731469) has the molecular formula C23H28BrN3O4S and a molecular weight of 522.47 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 100731469 |
| Molecular Formula | C23H28BrN3O4S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)[C@@H](C)N(Cc1ccc(Br)cc1)C(=O)CSCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H28BrN3O4S/c1-16(2)12-25-23(29)17(3)26(13-18-4-8-20(24)9-5-18)22(28)15-32-14-19-6-10-21(11-7-19)27(30)31/h4-11,16-17H,12-15H2,1-3H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | XEDRVUMVOOUSAN-QGZVFWFLSA-N |
| XLogP | 4.78 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|