C30H27NO2S — CID 10073197
ethyl (Z)-3-[2-(2-methylsulfanylphenyl)anilino]-2,3-diphenylprop-2-enoate (PubChem CID 10073197) has the molecular formula C30H27NO2S and a molecular weight of 465.62 g/mol. Its IUPAC name is ethyl (Z)-3-[2-(2-methylsulfanylphenyl)anilino]-2,3-diphenylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[2-(2-methylsulfanylphenyl)anilino]-2,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 10073197 |
| Molecular Formula | C30H27NO2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl (Z)-3-[2-(2-methylsulfanylphenyl)anilino]-2,3-diphenylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C(\Nc1ccccc1-c1ccccc1SC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO2S/c1-3-33-30(32)28(22-14-6-4-7-15-22)29(23-16-8-5-9-17-23)31-26-20-12-10-18-24(26)25-19-11-13-21-27(25)34-2/h4-21,31H,3H2,1-2H3/b29-28- |
| InChIKey | DXABSNLGVMOKJL-ZIADKAODSA-N |
| XLogP | 7.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|