C28H31BrN4O6S — CID 100732304
(2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 100732304) has the molecular formula C28H31BrN4O6S and a molecular weight of 631.55 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 100732304 |
| Molecular Formula | C28H31BrN4O6S |
| Molecular Weight | 631.55 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-bromophenyl)methyl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)[C@@H](C)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31BrN4O6S/c1-20(2)17-30-28(35)21(3)31(18-22-9-11-23(29)12-10-22)27(34)19-32(24-13-15-25(16-14-24)33(36)37)40(38,39)26-7-5-4-6-8-26/h4-16,20-21H,17-19H2,1-3H3,(H,30,35)/t21-/m1/s1 |
| InChIKey | BOFORVYHQPSNBZ-OAQYLSRUSA-N |
| XLogP | 4.74 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|