C18H20F2N2S — CID 100732775
1-(2,6-difluorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)propyl]thiourea (PubChem CID 100732775) has the molecular formula C18H20F2N2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)propyl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100732775 |
| Molecular Formula | C18H20F2N2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)propyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1c(F)cccc1F)c1ccc(C)cc1C |
| InChI | InChI=1S/C18H20F2N2S/c1-4-16(13-9-8-11(2)10-12(13)3)21-18(23)22-17-14(19)6-5-7-15(17)20/h5-10,16H,4H2,1-3H3,(H2,21,22,23)/t16-/m0/s1 |
| InChIKey | FZQBDDLPBOXABJ-INIZCTEOSA-N |
| XLogP | 5.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|