C17H11Cl3N2O2 — CID 100735074
2-(6-chloro-4-oxoquinolin-1-yl)-N-(2,4-dichlorophenyl)acetamide (PubChem CID 100735074) has the molecular formula C17H11Cl3N2O2 and a molecular weight of 381.65 g/mol. Its IUPAC name is 2-(6-chloro-4-oxoquinolin-1-yl)-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(6-chloro-4-oxoquinolin-1-yl)-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 100735074 |
| Molecular Formula | C17H11Cl3N2O2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 2-(6-chloro-4-oxoquinolin-1-yl)-N-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cn1ccc(=O)c2cc(Cl)ccc21)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl3N2O2/c18-10-2-4-15-12(7-10)16(23)5-6-22(15)9-17(24)21-14-3-1-11(19)8-13(14)20/h1-8H,9H2,(H,21,24) |
| InChIKey | OQANWIYLIAQWKF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |