C13H14Cl2N3O+ — CID 87584612
N-(2,4-dichlorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)acetamide (PubChem CID 87584612) has the molecular formula C13H14Cl2N3O+ and a molecular weight of 299.18 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 87584612 |
| Molecular Formula | C13H14Cl2N3O+ |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)acetamide |
| SMILES | Cc1n(CC(=O)Nc2ccc(Cl)cc2Cl)cc[n+]1C |
| InChI | InChI=1S/C13H13Cl2N3O/c1-9-17(2)5-6-18(9)8-13(19)16-12-4-3-10(14)7-11(12)15/h3-7H,8H2,1-2H3/p+1 |
| InChIKey | KPRSPNLIWVKPGQ-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|