C25H42N2O3 — CID 100738867
(2R)-2,4-dimethyl-N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxypentanamide (PubChem CID 100738867) has the molecular formula C25H42N2O3 and a molecular weight of 418.62 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxypentanamide.
| Compound Name | (2R)-2,4-dimethyl-N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxypentanamide |
|---|---|
| PubChem CID | 100738867 |
| Molecular Formula | C25H42N2O3 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | (2R)-2,4-dimethyl-N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxypentanamide |
| SMILES | CCCO[C@](C)(CC(C)C)C(=O)Nc1ccc(OCCCN2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C25H42N2O3/c1-6-17-30-25(5,19-20(2)3)24(28)26-22-11-13-23(14-12-22)29-18-9-16-27-15-8-7-10-21(27)4/h11-14,20-21H,6-10,15-19H2,1-5H3,(H,26,28)/t21-,25+/m0/s1 |
| InChIKey | RKNOXLGCMMAZAD-SQJMNOBHSA-N |
| XLogP | 5.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|