C26H44N2O3 — CID 125061186
(2R)-2-methyl-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxyheptanamide (PubChem CID 125061186) has the molecular formula C26H44N2O3 and a molecular weight of 432.65 g/mol. Its IUPAC name is (2R)-2-methyl-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxyheptanamide.
| Compound Name | (2R)-2-methyl-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxyheptanamide |
|---|---|
| PubChem CID | 125061186 |
| Molecular Formula | C26H44N2O3 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (2R)-2-methyl-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]-2-propoxyheptanamide |
| SMILES | CCCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCCCN2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C26H44N2O3/c1-5-7-9-17-26(4,31-20-6-2)25(29)27-23-13-15-24(16-14-23)30-21-11-19-28-18-10-8-12-22(28)3/h13-16,22H,5-12,17-21H2,1-4H3,(H,27,29)/t22-,26-/m1/s1 |
| InChIKey | SOJFYOFWYWWYNK-ATIYNZHBSA-N |
| XLogP | 6.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|