C19H15ClN2O4 — CID 100739164
N-(1,3-benzodioxol-5-ylmethyl)-2-(7-chloro-4-oxoquinolin-1-yl)acetamide (PubChem CID 100739164) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(7-chloro-4-oxoquinolin-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(7-chloro-4-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 100739164 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(7-chloro-4-oxoquinolin-1-yl)acetamide |
| SMILES | O=C(Cn1ccc(=O)c2ccc(Cl)cc21)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15ClN2O4/c20-13-2-3-14-15(8-13)22(6-5-16(14)23)10-19(24)21-9-12-1-4-17-18(7-12)26-11-25-17/h1-8H,9-11H2,(H,21,24) |
| InChIKey | BXUUFGWMQZTBLV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |