C22H20N2O3S2 — CID 100740079
3-benzyl-N-(2,3-dimethylphenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100740079) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-benzyl-N-(2,3-dimethylphenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-benzyl-N-(2,3-dimethylphenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100740079 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-benzyl-N-(2,3-dimethylphenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc3c(c2)sc(=O)n3Cc2ccccc2)c1C |
| InChI | InChI=1S/C22H20N2O3S2/c1-15-7-6-10-19(16(15)2)23-29(26,27)18-11-12-20-21(13-18)28-22(25)24(20)14-17-8-4-3-5-9-17/h3-13,23H,14H2,1-2H3 |
| InChIKey | NMXCTIQUBOYNLT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |