C22H34N2O5 — CID 100741579
(2R)-2-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-propoxyhexanamide (PubChem CID 100741579) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is (2R)-2-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-propoxyhexanamide.
| Compound Name | (2R)-2-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-propoxyhexanamide |
|---|---|
| PubChem CID | 100741579 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (2R)-2-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-propoxyhexanamide |
| SMILES | CCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H34N2O5/c1-4-6-11-22(3,29-14-5-2)21(26)23-18-7-9-19(10-8-18)28-17-20(25)24-12-15-27-16-13-24/h7-10H,4-6,11-17H2,1-3H3,(H,23,26)/t22-/m1/s1 |
| InChIKey | MVYAVQMOICPLCL-JOCHJYFZSA-N |
| XLogP | 3.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |