C23H25N3O3 — CID 100742188
1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methylquinolin-4-one (PubChem CID 100742188) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methylquinolin-4-one.
| Compound Name | 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methylquinolin-4-one |
|---|---|
| PubChem CID | 100742188 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methylquinolin-4-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3ccc(=O)c4cc(C)ccc43)CC2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-17-3-8-21-20(15-17)22(27)9-10-26(21)16-23(28)25-13-11-24(12-14-25)18-4-6-19(29-2)7-5-18/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | SGNFTWUVERVDHD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|