C26H27N5O3 — CID 50839654
5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methyl-1-phenylpyrazolo[4,5-c]pyridin-4-one (PubChem CID 50839654) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methyl-1-phenylpyrazolo[4,5-c]pyridin-4-one.
| Compound Name | 5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methyl-1-phenylpyrazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 50839654 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 5-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methyl-1-phenylpyrazolo[4,5-c]pyridin-4-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3ccc4c(c(C)nn4-c4ccccc4)c3=O)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O3/c1-19-25-23(31(27-19)21-6-4-3-5-7-21)12-13-30(26(25)33)18-24(32)29-16-14-28(15-17-29)20-8-10-22(34-2)11-9-20/h3-13H,14-18H2,1-2H3 |
| InChIKey | FGSWZIAZTOIXPJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|