C24H26N4O5 — CID 51364889
1-(2-methoxyphenyl)-4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione (PubChem CID 51364889) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione.
| Compound Name | 1-(2-methoxyphenyl)-4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 51364889 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3ccn(-c4ccccc4OC)c(=O)c3=O)CC2)cc1 |
| InChI | InChI=1S/C24H26N4O5/c1-32-19-9-7-18(8-10-19)25-11-13-26(14-12-25)22(29)17-27-15-16-28(24(31)23(27)30)20-5-3-4-6-21(20)33-2/h3-10,15-16H,11-14,17H2,1-2H3 |
| InChIKey | GYQOAESSVHQEEQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|