C24H25FN4O4 — CID 50928882
1-(2-ethoxyphenyl)-4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione (PubChem CID 50928882) has the molecular formula C24H25FN4O4 and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione.
| Compound Name | 1-(2-ethoxyphenyl)-4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 50928882 |
| Molecular Formula | C24H25FN4O4 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-(2-ethoxyphenyl)-4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione |
| SMILES | CCOc1ccccc1-n1ccn(CC(=O)N2CCN(c3ccccc3F)CC2)c(=O)c1=O |
| InChI | InChI=1S/C24H25FN4O4/c1-2-33-21-10-6-5-9-20(21)29-16-15-28(23(31)24(29)32)17-22(30)27-13-11-26(12-14-27)19-8-4-3-7-18(19)25/h3-10,15-16H,2,11-14,17H2,1H3 |
| InChIKey | ARDJZNFEQQVQGO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|