C25H28N4O5 — CID 51364891
1-(2-ethoxyphenyl)-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione (PubChem CID 51364891) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione.
| Compound Name | 1-(2-ethoxyphenyl)-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 51364891 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-(2-ethoxyphenyl)-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]pyrazine-2,3-dione |
| SMILES | CCOc1ccccc1-n1ccn(CC(=O)N2CCN(c3ccccc3OC)CC2)c(=O)c1=O |
| InChI | InChI=1S/C25H28N4O5/c1-3-34-22-11-7-5-9-20(22)29-17-16-28(24(31)25(29)32)18-23(30)27-14-12-26(13-15-27)19-8-4-6-10-21(19)33-2/h4-11,16-17H,3,12-15,18H2,1-2H3 |
| InChIKey | MARUXPJDYJGMHH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|