C26H23FN4O5 — CID 10074306
(4-azido-2-hydroxyphenyl)-[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methanone (PubChem CID 10074306) has the molecular formula C26H23FN4O5 and a molecular weight of 490.49 g/mol. Its IUPAC name is (4-azido-2-hydroxyphenyl)-[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methanone.
| Compound Name | (4-azido-2-hydroxyphenyl)-[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 10074306 |
| Molecular Formula | C26H23FN4O5 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (4-azido-2-hydroxyphenyl)-[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methanone |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)N2CCC(c3ccc(F)cc3)C(COc3ccc4c(c3)OCO4)C2)c(O)c1 |
| InChI | InChI=1S/C26H23FN4O5/c27-18-3-1-16(2-4-18)21-9-10-31(26(33)22-7-5-19(29-30-28)11-23(22)32)13-17(21)14-34-20-6-8-24-25(12-20)36-15-35-24/h1-8,11-12,17,21,32H,9-10,13-15H2 |
| InChIKey | IYVLSCLOOZLRTD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|