C25H29Cl2NO4 — CID 100743761
ethyl 2-butoxy-5-[[1-(2,4-dichlorophenyl)cyclopentanecarbonyl]amino]benzoate (PubChem CID 100743761) has the molecular formula C25H29Cl2NO4 and a molecular weight of 478.42 g/mol. Its IUPAC name is ethyl 2-butoxy-5-[[1-(2,4-dichlorophenyl)cyclopentanecarbonyl]amino]benzoate.
| Compound Name | ethyl 2-butoxy-5-[[1-(2,4-dichlorophenyl)cyclopentanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100743761 |
| Molecular Formula | C25H29Cl2NO4 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | ethyl 2-butoxy-5-[[1-(2,4-dichlorophenyl)cyclopentanecarbonyl]amino]benzoate |
| SMILES | CCCCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3Cl)CCCC2)cc1C(=O)OCC |
| InChI | InChI=1S/C25H29Cl2NO4/c1-3-5-14-32-22-11-9-18(16-19(22)23(29)31-4-2)28-24(30)25(12-6-7-13-25)20-10-8-17(26)15-21(20)27/h8-11,15-16H,3-7,12-14H2,1-2H3,(H,28,30) |
| InChIKey | DKUUBFKFBOURNX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|