C24H27Cl2NO5 — CID 100749887
ethyl 5-[[4-(2,4-dichlorophenyl)oxane-4-carbonyl]amino]-2-propoxybenzoate (PubChem CID 100749887) has the molecular formula C24H27Cl2NO5 and a molecular weight of 480.39 g/mol. Its IUPAC name is ethyl 5-[[4-(2,4-dichlorophenyl)oxane-4-carbonyl]amino]-2-propoxybenzoate.
| Compound Name | ethyl 5-[[4-(2,4-dichlorophenyl)oxane-4-carbonyl]amino]-2-propoxybenzoate |
|---|---|
| PubChem CID | 100749887 |
| Molecular Formula | C24H27Cl2NO5 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | ethyl 5-[[4-(2,4-dichlorophenyl)oxane-4-carbonyl]amino]-2-propoxybenzoate |
| SMILES | CCCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3Cl)CCOCC2)cc1C(=O)OCC |
| InChI | InChI=1S/C24H27Cl2NO5/c1-3-11-32-21-8-6-17(15-18(21)22(28)31-4-2)27-23(29)24(9-12-30-13-10-24)19-7-5-16(25)14-20(19)26/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,27,29) |
| InChIKey | CYTJDGLZCMMALJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |