C26H28F2N4O2Si — CID 10074475
1-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-3-phenylurea (PubChem CID 10074475) has the molecular formula C26H28F2N4O2Si and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-3-phenylurea.
| Compound Name | 1-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 10074475 |
| Molecular Formula | C26H28F2N4O2Si |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-3-phenylurea |
| SMILES | C[Si](C)(C)CCOCn1nc(NC(=O)Nc2ccccc2)c2cc(-c3ccccc3)c(F)c(F)c21 |
| InChI | InChI=1S/C26H28F2N4O2Si/c1-35(2,3)15-14-34-17-32-24-21(16-20(22(27)23(24)28)18-10-6-4-7-11-18)25(31-32)30-26(33)29-19-12-8-5-9-13-19/h4-13,16H,14-15,17H2,1-3H3,(H2,29,30,31,33) |
| InChIKey | LCUAIJVCGLCVRV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|