C17H15N3O2S2 — CID 100747220
4-(3-methoxyphenyl)-N-(3-methylsulfanylphenyl)thiadiazole-5-carboxamide (PubChem CID 100747220) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N-(3-methylsulfanylphenyl)thiadiazole-5-carboxamide.
| Compound Name | 4-(3-methoxyphenyl)-N-(3-methylsulfanylphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100747220 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-(3-methoxyphenyl)-N-(3-methylsulfanylphenyl)thiadiazole-5-carboxamide |
| SMILES | COc1cccc(-c2nnsc2C(=O)Nc2cccc(SC)c2)c1 |
| InChI | InChI=1S/C17H15N3O2S2/c1-22-13-7-3-5-11(9-13)15-16(24-20-19-15)17(21)18-12-6-4-8-14(10-12)23-2/h3-10H,1-2H3,(H,18,21) |
| InChIKey | OJZVZPYKHMJEKH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |