C19H25N3O4 — CID 100747646
N-[4-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylamino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 100747646) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[4-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylamino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylamino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 100747646 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[4-[[(5S)-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methylamino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | COc1ccc(C2=NO[C@H](CNC(=O)CCCNC(=O)C3CC3)C2)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-25-15-8-6-13(7-9-15)17-11-16(26-22-17)12-21-18(23)3-2-10-20-19(24)14-4-5-14/h6-9,14,16H,2-5,10-12H2,1H3,(H,20,24)(H,21,23)/t16-/m0/s1 |
| InChIKey | UIVUDFCSMYZNSW-INIZCTEOSA-N |
| XLogP | 1.61 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|