C30H22BrN5O3 — CID 100750288
6-bromo-2-[(3R)-5-(4-methoxyphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline (PubChem CID 100750288) has the molecular formula C30H22BrN5O3 and a molecular weight of 580.44 g/mol. Its IUPAC name is 6-bromo-2-[(3R)-5-(4-methoxyphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline.
| Compound Name | 6-bromo-2-[(3R)-5-(4-methoxyphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline |
|---|---|
| PubChem CID | 100750288 |
| Molecular Formula | C30H22BrN5O3 |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 6-bromo-2-[(3R)-5-(4-methoxyphenyl)-3-(2-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline |
| SMILES | COc1ccc(C2=NN(c3nc(-c4ccccc4)c4cc(Br)ccc4n3)[C@@H](c3ccccc3[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C30H22BrN5O3/c1-39-22-14-11-19(12-15-22)26-18-28(23-9-5-6-10-27(23)36(37)38)35(34-26)30-32-25-16-13-21(31)17-24(25)29(33-30)20-7-3-2-4-8-20/h2-17,28H,18H2,1H3/t28-/m1/s1 |
| InChIKey | YWFCCSCVLYRPNY-MUUNZHRXSA-N |
| XLogP | 7.33 |
| TPSA | 93.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|