C29H19BrClN5O2 — CID 4522253
6-bromo-2-[3-(2-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline (PubChem CID 4522253) has the molecular formula C29H19BrClN5O2 and a molecular weight of 584.86 g/mol. Its IUPAC name is 6-bromo-2-[3-(2-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline.
| Compound Name | 6-bromo-2-[3-(2-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline |
|---|---|
| PubChem CID | 4522253 |
| Molecular Formula | C29H19BrClN5O2 |
| Molecular Weight | 584.86 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 6-bromo-2-[3-(2-chlorophenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-phenylquinazoline |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3nc(-c4ccccc4)c4cc(Br)ccc4n3)C(c3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C29H19BrClN5O2/c30-20-12-15-25-23(16-20)28(19-6-2-1-3-7-19)33-29(32-25)35-27(22-8-4-5-9-24(22)31)17-26(34-35)18-10-13-21(14-11-18)36(37)38/h1-16,27H,17H2 |
| InChIKey | JWWAJIIEXINAQD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 84.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.86 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|