C21H21N3O2S — CID 100751464
(2R)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide (PubChem CID 100751464) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is (2R)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide.
| Compound Name | (2R)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
|---|---|
| PubChem CID | 100751464 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (2R)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
| SMILES | C[C@@H](Oc1cccc2c1CCCC2)C(=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14(26-18-13-7-11-15-8-5-6-12-17(15)18)19(25)22-21-24-23-20(27-21)16-9-3-2-4-10-16/h2-4,7,9-11,13-14H,5-6,8,12H2,1H3,(H,22,24,25)/t14-/m1/s1 |
| InChIKey | HKVAIRWJNHMCQL-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |