C18H27NO5 — CID 100754818
ethyl 2-methoxy-5-[[(2S)-2-methoxy-2-methylhexanoyl]amino]benzoate (PubChem CID 100754818) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl 2-methoxy-5-[[(2S)-2-methoxy-2-methylhexanoyl]amino]benzoate.
| Compound Name | ethyl 2-methoxy-5-[[(2S)-2-methoxy-2-methylhexanoyl]amino]benzoate |
|---|---|
| PubChem CID | 100754818 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethyl 2-methoxy-5-[[(2S)-2-methoxy-2-methylhexanoyl]amino]benzoate |
| SMILES | CCCC[C@](C)(OC)C(=O)Nc1ccc(OC)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C18H27NO5/c1-6-8-11-18(3,23-5)17(21)19-13-9-10-15(22-4)14(12-13)16(20)24-7-2/h9-10,12H,6-8,11H2,1-5H3,(H,19,21)/t18-/m0/s1 |
| InChIKey | DMGKBSPTAWBUGS-SFHVURJKSA-N |
| XLogP | 3.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |