C23H37NO5 — CID 100761247
ethyl 2-[(2S)-butan-2-yl]oxy-5-[[(2R)-2-ethoxy-2-methylheptanoyl]amino]benzoate (PubChem CID 100761247) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is ethyl 2-[(2S)-butan-2-yl]oxy-5-[[(2R)-2-ethoxy-2-methylheptanoyl]amino]benzoate.
| Compound Name | ethyl 2-[(2S)-butan-2-yl]oxy-5-[[(2R)-2-ethoxy-2-methylheptanoyl]amino]benzoate |
|---|---|
| PubChem CID | 100761247 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | ethyl 2-[(2S)-butan-2-yl]oxy-5-[[(2R)-2-ethoxy-2-methylheptanoyl]amino]benzoate |
| SMILES | CCCCC[C@@](C)(OCC)C(=O)Nc1ccc(O[C@@H](C)CC)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C23H37NO5/c1-7-11-12-15-23(6,28-10-4)22(26)24-18-13-14-20(29-17(5)8-2)19(16-18)21(25)27-9-3/h13-14,16-17H,7-12,15H2,1-6H3,(H,24,26)/t17-,23+/m0/s1 |
| InChIKey | PPGLYYWEMNVRBD-GAJHUEQPSA-N |
| XLogP | 5.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|