C22H35NO5 — CID 133203893
methyl 2-butan-2-yloxy-5-[(2-ethoxy-2-methylheptanoyl)amino]benzoate (PubChem CID 133203893) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is methyl 2-butan-2-yloxy-5-[(2-ethoxy-2-methylheptanoyl)amino]benzoate.
| Compound Name | methyl 2-butan-2-yloxy-5-[(2-ethoxy-2-methylheptanoyl)amino]benzoate |
|---|---|
| PubChem CID | 133203893 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | methyl 2-butan-2-yloxy-5-[(2-ethoxy-2-methylheptanoyl)amino]benzoate |
| SMILES | CCCCCC(C)(OCC)C(=O)Nc1ccc(OC(C)CC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C22H35NO5/c1-7-10-11-14-22(5,27-9-3)21(25)23-17-12-13-19(28-16(4)8-2)18(15-17)20(24)26-6/h12-13,15-16H,7-11,14H2,1-6H3,(H,23,25) |
| InChIKey | ADNPFDDKZJECAN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|