C16H23ClN4O2 — CID 100755826
(3R)-3-[[2-[(2-chlorophenyl)methyl-ethylamino]acetyl]amino]pyrrolidine-1-carboxamide (PubChem CID 100755826) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is (3R)-3-[[2-[(2-chlorophenyl)methyl-ethylamino]acetyl]amino]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-[[2-[(2-chlorophenyl)methyl-ethylamino]acetyl]amino]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 100755826 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (3R)-3-[[2-[(2-chlorophenyl)methyl-ethylamino]acetyl]amino]pyrrolidine-1-carboxamide |
| SMILES | CCN(CC(=O)N[C@@H]1CCN(C(N)=O)C1)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN4O2/c1-2-20(9-12-5-3-4-6-14(12)17)11-15(22)19-13-7-8-21(10-13)16(18)23/h3-6,13H,2,7-11H2,1H3,(H2,18,23)(H,19,22)/t13-/m1/s1 |
| InChIKey | NDWUYOAGBCVYHF-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |