C16H22N6O2 — CID 100759678
4-[(3S)-3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-nitroaniline (PubChem CID 100759678) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-[(3S)-3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-nitroaniline.
| Compound Name | 4-[(3S)-3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-nitroaniline |
|---|---|
| PubChem CID | 100759678 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-[(3S)-3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]-3-nitroaniline |
| SMILES | Cc1nc(C)n(C[C@H]2CCCN(c3ccc(N)cc3[N+](=O)[O-])C2)n1 |
| InChI | InChI=1S/C16H22N6O2/c1-11-18-12(2)21(19-11)10-13-4-3-7-20(9-13)15-6-5-14(17)8-16(15)22(23)24/h5-6,8,13H,3-4,7,9-10,17H2,1-2H3/t13-/m0/s1 |
| InChIKey | FASMRCLKQHFFNR-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|