C18H25N5O2 — CID 122138472
3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-1-[(4-methyl-3-nitrophenyl)methyl]piperidine (PubChem CID 122138472) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-1-[(4-methyl-3-nitrophenyl)methyl]piperidine.
| Compound Name | 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-1-[(4-methyl-3-nitrophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 122138472 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-1-[(4-methyl-3-nitrophenyl)methyl]piperidine |
| SMILES | Cc1nc(C)n(CC2CCCN(Cc3ccc(C)c([N+](=O)[O-])c3)C2)n1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-6-7-16(9-18(13)23(24)25)10-21-8-4-5-17(11-21)12-22-15(3)19-14(2)20-22/h6-7,9,17H,4-5,8,10-12H2,1-3H3 |
| InChIKey | JYONWYPRMMQWSQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|