C22H22ClN5O2S — CID 100760010
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea (PubChem CID 100760010) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100760010 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
| SMILES | O=C(c1ccc(NC(=S)NCc2nc(-c3ccc(Cl)cc3)no2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H22ClN5O2S/c23-17-8-4-15(5-9-17)20-26-19(30-27-20)14-24-22(31)25-18-10-6-16(7-11-18)21(29)28-12-2-1-3-13-28/h4-11H,1-3,12-14H2,(H2,24,25,31) |
| InChIKey | JVEVJPARKYHVOP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|