C14H19N3O5S — CID 100760294
1-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methylamino]-2-nitrophenyl]ethanone (PubChem CID 100760294) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methylamino]-2-nitrophenyl]ethanone.
| Compound Name | 1-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methylamino]-2-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 100760294 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methylamino]-2-nitrophenyl]ethanone |
| SMILES | CC(=O)c1cc(NC[C@@H]2CCN(S(C)(=O)=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O5S/c1-10(18)13-7-12(3-4-14(13)17(19)20)15-8-11-5-6-16(9-11)23(2,21)22/h3-4,7,11,15H,5-6,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | BHVQJQAREHPEQM-NSHDSACASA-N |
| XLogP | 1.49 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|