C30H35N5O5 — CID 10076109
methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 10076109) has the molecular formula C30H35N5O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10076109 |
| Molecular Formula | C30H35N5O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2cccc[n+]2[O-])n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C30H35N5O5/c1-4-6-11-27-31-19-25(33(27)20-22-12-14-23(15-13-22)29(37)40-3)18-26-28(36)32(16-7-5-2)30(38)34(26)21-24-10-8-9-17-35(24)39/h8-10,12-15,17-19H,4-7,11,16,20-21H2,1-3H3/b26-18- |
| InChIKey | METOVTOATLTHQU-ITYLOYPMSA-N |
| XLogP | 4.30 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|