C27H36N4O4 — CID 10254585
4-[[2-butyl-5-[(Z)-(1,3-dibutyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 10254585) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-[[2-butyl-5-[(Z)-(1,3-dibutyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[(Z)-(1,3-dibutyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10254585 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 4-[[2-butyl-5-[(Z)-(1,3-dibutyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2CCCC)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H36N4O4/c1-4-7-10-24-28-18-22(31(24)19-20-11-13-21(14-12-20)26(33)34)17-23-25(32)30(16-9-6-3)27(35)29(23)15-8-5-2/h11-14,17-18H,4-10,15-16,19H2,1-3H3,(H,33,34)/b23-17- |
| InChIKey | XYGCGZJECLFCKR-QJOMJCCJSA-N |
| XLogP | 5.18 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|