C28H32N4O4S — CID 10414338
4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 10414338) has the molecular formula C28H32N4O4S and a molecular weight of 520.66 g/mol. Its IUPAC name is 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10414338 |
| Molecular Formula | C28H32N4O4S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(thiophen-2-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2cccs2)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H32N4O4S/c1-3-5-9-25-29-17-22(31(25)18-20-10-12-21(13-11-20)27(34)35)16-24-26(33)30(14-6-4-2)28(36)32(24)19-23-8-7-15-37-23/h7-8,10-13,15-17H,3-6,9,14,18-19H2,1-2H3,(H,34,35)/b24-16- |
| InChIKey | GZLUZVHIHGZGIG-JLPGSUDCSA-N |
| XLogP | 5.64 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|